CymitQuimica logo

CAS 75638-59-4

:

(2S,3R)-3-Amino-2-hydroxyhexanoic acid

Description:
(2S,3R)-3-Amino-2-hydroxyhexanoic acid, also known as L-threonine, is an essential amino acid characterized by its aliphatic side chain containing a hydroxyl group. This compound is a colorless, crystalline solid that is soluble in water, reflecting its polar nature due to the presence of both amino and hydroxyl functional groups. As an amino acid, it plays a crucial role in protein synthesis and is involved in various metabolic processes. L-threonine is particularly important for the synthesis of glycine and serine, and it contributes to the production of antibodies and the maintenance of immune function. Its stereochemistry, indicated by the (2S,3R) configuration, is significant for its biological activity, as only specific enantiomers of amino acids are utilized by living organisms. Additionally, L-threonine is commonly found in various food sources, including dairy products, meat, and certain grains, making it an important dietary component for humans and animals alike.
Formula:C6H13NO3
InChI:InChI=1/C6H13NO3/c1-2-3-4(7)5(8)6(9)10/h4-5,8H,2-3,7H2,1H3,(H,9,10)/t4-,5+/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • (2S,3R)-3-Amino-2-hydroxyhexanoic Acid

    Controlled Product
    CAS:
    Formula:C6H13NO3
    Color and Shape:Neat
    Molecular weight:147.172

    Ref: TR-S295910

    100mg
    3,428.00€