CAS 75638-60-7

Hexanoic acid, 3-amino-2-hydroxy-, [R-(R*,R*)]-

Description:

Hexanoic acid, 3-amino-2-hydroxy-, [R-(R*,R*)]- is an organic compound characterized by its carboxylic acid functional group, an amino group, and a hydroxyl group, which contribute to its unique properties. This compound features a six-carbon chain (hexanoic acid) with an amino group at the third carbon and a hydroxyl group at the second carbon, indicating it is an amino alcohol. The presence of these functional groups suggests that it may exhibit both acidic and basic properties, allowing it to participate in various chemical reactions, including esterification and amide formation. The stereochemistry indicated by the [R-(R*,R*)] notation suggests specific spatial arrangements of its substituents, which can influence its biological activity and interactions. Hexanoic acid derivatives are often studied for their potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Additionally, the compound's solubility in polar solvents and its ability to form hydrogen bonds due to the hydroxyl and amino groups enhance its reactivity and potential utility in various chemical processes.

Formula: C₆H₁₃NO₃

InChI: InChI=1S/C6H13NO3/c1-2-3-4(7)5(8)6(9)10/h4-5,8H,2-3,7H2,1H3,(H,9,10)/t4-,5-/m1/s1

InChI key: InChIKey=OIFGOYXLBOWNGQ-RFZPGFLSSA-N

SMILES: [C@@H]([C@@H](CCC)N)(C(O)=O)O

Synonyms:

• Hexanoic acid, 3-amino-2-hydroxy-, [R-(R*,R*)]-