CAS 756437-41-9

5,6,7,8-Tetrahydropyrido[4,3-d]pyrimidin-4(3H)-one

Description:

5,6,7,8-Tetrahydropyrido[4,3-d]pyrimidin-4(3H)-one is a heterocyclic organic compound characterized by its fused pyridine and pyrimidine rings. This compound features a tetrahydro structure, indicating the presence of four hydrogen atoms that saturate the ring system, contributing to its stability and reactivity. The presence of a carbonyl group (C=O) at the 4-position of the pyrimidine ring is significant for its chemical properties, influencing its potential as a bioactive molecule. The compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of nitrogen atoms in the ring structure, which can engage in hydrogen bonding. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The CAS number 756437-41-9 serves as a unique identifier for this compound, facilitating its identification in chemical databases and literature. Overall, this compound's structural features and functional groups make it a subject of interest for further research and application in various fields.

Formula: C₇H₉N₃O

InChI: InChI=1/C7H9N3O.ClH/c11-7-5-3-8-2-1-6(5)9-4-10-7;/h4,8H,1-3H2,(H,9,10,11);1H

SMILES: C1CNCc2c1ncnc2O.Cl

Synonyms:

• Pyrido[4,3-d]pyrimidin-4(3H)-one, 5,6,7,8-tetrahydro-

Pyrido[4,3-d]pyrimidin-4(1H)-one, 5,6,7,8-tetrahydro-

CAS: 756437-41-9

Formula: C₇H₉N₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 151.1659

Ref: IN-DA00ICNC