CAS 75645-24-8
:beta-D-galactopyranosyl-(1->3)-2-(acetylamino)-2-deoxy-beta-D-galactopyranosyl-(1->4)-beta-D-galactopyranosyl-(1->4)-D-glucose
Description:
Beta-D-galactopyranosyl-(1->3)-2-(acetylamino)-2-deoxy-beta-D-galactopyranosyl-(1->4)-beta-D-galactopyranosyl-(1->4)-D-glucose, with CAS number 75645-24-8, is a complex carbohydrate, specifically a glycoside. This compound is characterized by its multiple sugar units, including galactose and glucose, linked through specific glycosidic bonds. The presence of an acetylamino group indicates that it is an amino sugar derivative, which can influence its solubility and biological activity. The structural configuration suggests that it may play a role in biological processes, such as cell recognition and signaling, due to the presence of multiple hydroxyl groups that can participate in hydrogen bonding. Additionally, its glycosidic linkages contribute to its stability and resistance to enzymatic degradation. This compound may be of interest in biochemical research, particularly in studies related to polysaccharides, glycoproteins, and their interactions in biological systems. Its specific properties, such as solubility and reactivity, would depend on the surrounding conditions, including pH and temperature.
Formula:C26H45NO21
InChI:InChI=1/C26H45NO21/c1-7(33)27-13-23(48-25-19(41)17(39)15(37)10(4-30)44-25)16(38)11(5-31)43-24(13)47-22-12(6-32)45-26(20(42)18(22)40)46-21(9(35)3-29)14(36)8(34)2-28/h2,8-26,29-32,34-42H,3-6H2,1H3,(H,27,33)/t8-,9+,10+,11+,12+,13+,14+,15-,16-,17-,18+,19+,20+,21+,22-,23+,24-,25-,26-/m0/s1
Synonyms:- Asiaol-Gm1-tetrasaccharide
- D-Glucose, O-β-D-galactopyranosyl-(1→3)-O-2-(acetylamino)-2-deoxy-β-D-galactopyranosyl-(1→4)-O-β-D-galactopyranosyl-(1→4)-
- Gangliotetraose
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Gangliotetraose
CAS:<p>Gangliotetraose (Galβ1,3GalNAcβ1,4Galβ1,4Glc) is the core tetrasaccharide found in many gangliosides, such as, GM1 (Ledeen, 2009). Gangliosides containing gangliotetraose are abundant in mammalian brains, where they can cover 10%â20% of the total ganglioside mixture. They are found in epithelial membranes and are key elements for bacterial toxicity and viral infection, for example, it is the intestinal receptor for cholera toxin, the B-subunits of heat-labile toxin, rotavirus, and simian virus 40. They can function as neurotrophic and neuroprotective compounds, and have been used therapeutically for diabetic and peripheral neuropathies. They bind amyloid-β proteins and are involved in Alzheimerâs pathogenesis (Chiricozzi, 2020).</p>Formula:C26H45NO21Purity:Min. 95%Color and Shape:PowderMolecular weight:707.64 g/mol

