CymitQuimica logo

CAS 756484-20-5

:

1-[3′-(Phenylmethoxy)[1,1′-biphenyl]-4-yl]ethanone

Description:
1-[3′-(Phenylmethoxy)[1,1′-biphenyl]-4-yl]ethanone, with the CAS number 756484-20-5, is an organic compound characterized by its complex structure that includes a ketone functional group and a biphenyl moiety. This compound features a phenylmethoxy group attached to a biphenyl backbone, which contributes to its potential as a ligand in various chemical reactions or as a building block in organic synthesis. The presence of the ethanone group indicates that it has a carbonyl functionality, which can participate in nucleophilic addition reactions. The compound's molecular structure suggests it may exhibit interesting electronic properties due to the conjugation between the aromatic rings, potentially influencing its reactivity and interactions with other molecules. Additionally, the presence of multiple aromatic systems may impart stability and influence solubility in organic solvents. Overall, this compound's unique structural features make it a subject of interest in fields such as medicinal chemistry and materials science.
Formula:C21H18O2
InChI:InChI=1S/C21H18O2/c1-16(22)18-10-12-19(13-11-18)20-8-5-9-21(14-20)23-15-17-6-3-2-4-7-17/h2-14H,15H2,1H3
InChI key:InChIKey=BYFBNVVTFNNRAL-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C=2C=C(C3=CC=C(C(C)=O)C=C3)C=CC2
Synonyms:
  • 1-[3′-(Benzyloxy)[1,1′-biphenyl]-4-yl]ethanone
  • Ethanone, 1-[3′-(phenylmethoxy)[1,1′-biphenyl]-4-yl]-
  • 1-[3′-(Phenylmethoxy)[1,1′-biphenyl]-4-yl]ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.