CAS 756485-02-6

4-(3-Acetylphenoxy)butanoic acid

Description:

4-(3-Acetylphenoxy)butanoic acid is an organic compound characterized by its structure, which includes a butanoic acid moiety linked to a phenoxy group that is further substituted with an acetyl group. This compound typically exhibits properties associated with both aromatic and aliphatic functionalities, contributing to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the acetyl group may enhance its lipophilicity, influencing its solubility and biological activity. As a carboxylic acid, it can participate in acid-base reactions and may form salts or esters under appropriate conditions. The compound's molecular interactions are likely influenced by hydrogen bonding due to the carboxylic acid group, while the aromatic ring can engage in π-π stacking interactions. Overall, 4-(3-Acetylphenoxy)butanoic acid is a versatile compound with potential utility in synthetic chemistry and medicinal applications, although specific biological activities and reactivity would require further investigation through empirical studies.

Formula: C₁₂H₁₄O₄

InChI: InChI=1S/C12H14O4/c1-9(13)10-4-2-5-11(8-10)16-7-3-6-12(14)15/h2,4-5,8H,3,6-7H2,1H3,(H,14,15)

InChI key: InChIKey=XGZBCEWPYFSMNG-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=CC(OCCCC(O)=O)=CC=C1

Synonyms:

• Butanoic acid, 4-(3-acetylphenoxy)-
• 4-(3-Acetylphenoxy)butanoic acid

4-(3-Acetylphenoxy)butanoic acid

Controlled Product

CAS: 756485-02-6

Versatile small molecule scaffold

Formula: C₁₂H₁₄O₄

Purity: Min. 95%

Molecular weight: 222.24 g/mol

Ref: 3D-GFB48502