CymitQuimica logo

CAS 756489-25-5

:

4-(4-fluorophenyl)-4-oxo-butanenitrile

Description:
4-(4-Fluorophenyl)-4-oxo-butanenitrile, identified by its CAS number 756489-25-5, is an organic compound characterized by the presence of a nitrile functional group and a ketone moiety. This compound features a butanenitrile backbone with a fluorophenyl substituent, which contributes to its chemical properties and potential reactivity. The fluorine atom on the phenyl ring can influence the compound's electronic characteristics, potentially enhancing its lipophilicity and affecting its interactions in biological systems. The presence of both the carbonyl and nitrile groups suggests that this compound may participate in various chemical reactions, including nucleophilic additions and condensation reactions. Its structural features may also indicate potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. As with many organic compounds, its physical properties, such as solubility, melting point, and boiling point, would depend on the specific molecular interactions and the environment in which it is studied.
Formula:C10H8FNO
InChI:InChI=1/C10H8FNO/c11-9-5-3-8(4-6-9)10(13)2-1-7-12/h3-6H,1-2H2
SMILES:C(CC(=O)c1ccc(cc1)F)C#N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.