CymitQuimica logo

CAS 7565-19-7

:

1-benzyl-1-methylguanidine

Description:
1-Benzyl-1-methylguanidine is an organic compound characterized by its guanidine structure, which features a benzyl group and a methyl group attached to the nitrogen atoms. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. It exhibits basic properties due to the presence of the guanidine moiety, which can participate in protonation reactions. 1-Benzyl-1-methylguanidine is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of various pharmaceuticals. Its biological activity may include interactions with neurotransmitter systems, making it of interest in neuropharmacology. Additionally, the compound may serve as a ligand in coordination chemistry due to its ability to coordinate with metal ions. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate safety measures to avoid exposure.
Formula:C9H13N3
InChI:InChI=1/C9H13N3/c1-12(9(10)11)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H3,10,11)
SMILES:CN(Cc1ccccc1)C(=N)N
Synonyms:
  • guanidine, N-methyl-N-(phenylmethyl)-
  • 1-Benzyl-1-methylguanidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.