CymitQuimica logo

CAS 7565-21-1

:

N-(3-Phenylpropyl)guanidine

Description:
N-(3-Phenylpropyl)guanidine is an organic compound characterized by its guanidine functional group, which is known for its basicity and ability to form hydrogen bonds. This compound features a phenylpropyl side chain, contributing to its hydrophobic characteristics and potential interactions with biological systems. It typically appears as a white to off-white solid and is soluble in polar solvents, reflecting its polar functional groups. The presence of the guanidine moiety suggests that it may exhibit biological activity, potentially acting as a ligand or modulator in various biochemical pathways. Its structure allows for the possibility of forming complexes with metal ions or other biomolecules, making it of interest in medicinal chemistry and pharmacology. Additionally, due to its basic nature, N-(3-Phenylpropyl)guanidine may participate in acid-base reactions, influencing its behavior in different chemical environments. Overall, this compound's unique structural features and properties make it a subject of interest in both synthetic and applied chemistry contexts.
Formula:C10H15N3
InChI:InChI=1S/C10H15N3/c11-10(12)13-8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H4,11,12,13)
InChI key:InChIKey=WIPPGLNWEIAUEV-UHFFFAOYSA-N
SMILES:C(CCNC(=N)N)C1=CC=CC=C1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.