CymitQuimica logo

CAS 7565-59-5

:

bromozinc(1+) 2-methylpropan-2-ide

Description:
Bromozinc(1+) 2-methylpropan-2-ide, with the CAS number 7565-59-5, is a chemical compound that features a zinc cation coordinated with a bromide anion and a 2-methylpropan-2-ide ligand. This compound typically exhibits characteristics associated with organozinc compounds, such as being a colorless or light-colored solid or liquid, depending on its physical state at room temperature. It is known for its reactivity, particularly in organic synthesis, where it can act as a nucleophile or a reagent in various coupling reactions. The presence of the bromide ion suggests potential applications in halogenation reactions or as a source of bromine in synthetic pathways. Additionally, the steric bulk of the 2-methylpropan-2-ide group may influence the compound's reactivity and selectivity in chemical reactions. Safety precautions should be observed when handling this compound, as organozinc compounds can be sensitive to moisture and air, potentially leading to hazardous reactions.
Formula:C4H9BrZn
InChI:InChI=1/C4H9.BrH.Zn/c1-4(2)3;;/h1-3H3;1H;/q-1;;+2/p-1/rC4H9.BrZn/c1-4(2)3;1-2/h1-3H3;/q-1;+1
SMILES:C[C-](C)C.Br.[Zn]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.