CAS 756525-98-1
:3-[2-[2-[[3-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]ethoxy]ethoxy]propanoic acid
Description:
3-[2-[2-[[3-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]ethoxy]ethoxy]propanoic acid, with CAS number 756525-98-1, is a synthetic organic compound characterized by its complex structure, which includes a pyrrole ring and multiple ether linkages. This compound features a propanoic acid moiety, indicating it has acidic properties, and the presence of an amino group suggests potential for forming hydrogen bonds, enhancing its solubility in polar solvents. The dihydropyrrole component contributes to its reactivity and potential biological activity, making it of interest in medicinal chemistry. Its multi-functional nature allows for various interactions, which could be leveraged in drug design or as a biochemical probe. The compound's stability, solubility, and reactivity are influenced by its functional groups, and it may exhibit specific pharmacological properties, although detailed biological activity would require further investigation. Overall, this compound exemplifies the complexity often found in pharmaceutical agents, combining structural features that may contribute to its efficacy in biological systems.
Formula:C14H20N2O7
InChI:InChI=1S/C14H20N2O7/c17-11(3-6-16-12(18)1-2-13(16)19)15-5-8-23-10-9-22-7-4-14(20)21/h1-2H,3-10H2,(H,15,17)(H,20,21)
InChI key:InChIKey=GBPJQBDDYXDSNH-UHFFFAOYSA-N
SMILES:C(CC(NCCOCCOCCC(O)=O)=O)N1C(=O)C=CC1=O
Synonyms:- 3-[2-[2-[[3-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]ethoxy]ethoxy]propanoic acid
- Propanoic acid, 3-[2-[2-[[3-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]ethoxy]ethoxy]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-[2-[2-[[3-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]ethoxy]ethoxy]propanoic acid
CAS:Formula:C14H20N2O7Purity:97%Color and Shape:SolidMolecular weight:328.3178Mal-amido-PEG2-C2-acid
CAS:Mal-amido-PEG2-C2-acid is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.Formula:C14H20N2O7Color and Shape:SolidMolecular weight:328.323-[2-[2-[[3-(2,5-DIHYDRO-2,5-DIOXO-1H-PYRROL-1-YL)-1-OXOPROPYL]AMINO]ETHOXY]ETHOXY]PROPANOIC ACID
CAS:Purity:97%Molecular weight:328.3210144Mal-PEG2-COOH
CAS:Mal-PEG2-COOH is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Mal-PEG2-COOH is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.Formula:C14H20N2O7Purity:Min. 95%Molecular weight:328.32 g/mol




