CAS 756526-04-2
:27-Amino-4,7,10,13,16,19,22,25-octaoxaheptacosanoic acid
Description:
27-Amino-4,7,10,13,16,19,22,25-octaoxaheptacosanoic acid is a synthetic compound characterized by its long carbon chain and multiple ether linkages due to the presence of eight oxygen atoms in its structure. The presence of an amino group indicates that it can participate in various chemical reactions, including those typical of amines, such as nucleophilic substitutions. This compound is likely to exhibit amphiphilic properties, making it potentially useful in applications such as surfactants, emulsifiers, or drug delivery systems. Its long hydrophobic carbon chain contributes to its ability to interact with lipid membranes, while the hydrophilic segments can facilitate solubility in aqueous environments. The structural complexity and functional groups suggest that it may also have potential biological activity, although specific biological properties would require further investigation. Overall, this compound exemplifies the diverse functionalities that can arise from synthetic organic chemistry, particularly in the context of materials science and biochemistry.
Formula:C19H39NO10
InChI:InChI=1S/C19H39NO10/c20-2-4-24-6-8-26-10-12-28-14-16-30-18-17-29-15-13-27-11-9-25-7-5-23-3-1-19(21)22/h1-18,20H2,(H,21,22)
InChI key:InChIKey=YLKOHZCQTVYVDB-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCOCCOCCN)CCOCCOCCC(O)=O
Synonyms:- 27-Amino-4,7,10,13,16,19,22,25-octaoxaheptacosanoic acid
- H2N-PEG8-CH2CH2COOH
- 4,7,10,13,16,19,22,25-Octaoxaheptacosanoic acid, 27-amino-
- Amino-PEG8-COOH
- AMINE-PEG8-COOH
- alpha-aMine-oMega-propionic acid octaethylene glycol
- 3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid
- 27-Amino-4,7,10,13,16,19,22,25-octaoxaheptacosanoic acid
- 4,7,10,13,16,19,22,25-Octaoxaheptacosanoic acid, 27-amino-
- 1-Amino-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oic acid
- amino-dPEG 8-acid
- H2N-PEG8-CH2CH2COOH/4,7,10,13,16,19,22,25-Octaoxaheptacosanoic acid, 27-amino-
- Amino-dPEG(R)8-acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
α-aMine-ω-propionic acid octaethylene glycol
CAS:Formula:C19H39NO10Purity:95%Color and Shape:LiquidMolecular weight:441.5137NH2-PEG8-acid
CAS:NH2-PEG9-acid is a non-cleavable 9 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1].Formula:C19H39NO10Purity:99.72%Color and Shape:SolidMolecular weight:441.51Amino-PEG8-Acid
CAS:Amino-PEG8-AcidFormula:C19H39NO10Purity:96% (Typical Value in Batch COA)Color and Shape: solidMolecular weight:441.51g/molH2N-PEG8-CH2CH2COOH
CAS:H2N-PEG8-CH2CH2COOH is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. H2N-PEG8-CH2CH2COOH is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.Formula:C19H39NO10Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:441.51 g/mol1-Amino-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oic acid
CAS:Purity:97%Molecular weight:441.5180054Amino-dPEG® Acid
CAS:Amino-dPEG® Acid is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Amino-dPEG® Acid is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.
Purity:Min. 95%Molecular weight:441.51 g/mol




