CAS 75655-45-7

2,3-Dihydro-3-methyl-2-oxo-1H-benzimidazole-1-propanoic acid

Description:

2,3-Dihydro-3-methyl-2-oxo-1H-benzimidazole-1-propanoic acid, with the CAS number 75655-45-7, is a chemical compound that belongs to the class of benzimidazole derivatives. This substance typically exhibits a bicyclic structure, characterized by a fused benzene and imidazole ring, which contributes to its biological activity. The presence of a propanoic acid moiety suggests that it has acidic properties, potentially influencing its solubility and reactivity in various environments. The methyl and keto groups enhance its structural complexity and may play a role in its interaction with biological targets. Compounds of this nature are often investigated for their pharmacological properties, including potential antimicrobial or anti-inflammatory effects. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 2,3-Dihydro-3-methyl-2-oxo-1H-benzimidazole-1-propanoic acid represents a unique structure with potential applications in medicinal chemistry and drug development.

Formula: C₁₁H₁₂N₂O₃

InChI: InChI=1S/C11H12N2O3/c1-12-8-4-2-3-5-9(8)13(11(12)16)7-6-10(14)15/h2-5H,6-7H2,1H3,(H,14,15)

InChI key: InChIKey=GKRUPQCGSGTQDB-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1C=2C(N(C)C1=O)=CC=CC2

Synonyms:

• 2,3-Dihydro-3-methyl-2-oxo-1H-benzimidazole-1-propanoic acid
• 1H-Benzimidazole-1-propanoic acid, 2,3-dihydro-3-methyl-2-oxo-

3-(3-Methyl-2-oxo-2,3-dihydro-benzoimidazol-1-yl)-propionic acid

CAS: 75655-45-7

Versatile small molecule scaffold

Formula: C₁₁H₁₂N₂O₃

Purity: Min. 95%

Molecular weight: 220.22 g/mol

Ref: 3D-ADA65545