CAS 75656-33-6

α-D-Galactosamine 1-phosphate monohydrate

Description:

α-D-Galactosamine 1-phosphate monohydrate is an amino sugar derivative of galactose, characterized by the presence of an amino group and a phosphate group attached to the sugar backbone. This compound is typically found in a monohydrate form, indicating the presence of one water molecule per molecule of the substance. It plays a significant role in various biochemical pathways, particularly in the metabolism of glycoproteins and glycolipids. The phosphate group contributes to its solubility in water and its reactivity in biochemical processes. α-D-Galactosamine 1-phosphate is involved in cellular signaling and can influence the synthesis of glycosaminoglycans. Its structural features include a pyranose ring and stereochemistry that is crucial for its biological function. As a chemical entity, it is typically handled with care in laboratory settings, and its stability can be influenced by environmental factors such as pH and temperature. Overall, this compound is significant in both research and potential therapeutic applications, particularly in understanding metabolic disorders.

Formula: C₆H₁₄NO₈P·H₂O

InChI: InChI=1S/C6H14NO8P.H2O/c7-3-5(10)4(9)2(1-8)14-6(3)15-16(11,12)13;/h2-6,8-10H,1,7H2,(H2,11,12,13);1H2/t2-,3-,4+,5-,6-;/m1./s1

InChI key: InChIKey=KPOAUMIAJAOYLX-WYRLRVFGSA-N

SMILES: O(P(=O)(O)O)[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1N.O

Synonyms:

• α-D-Galactosamine 1-phosphate monohydrate
• α-D-Galactopyranose, 2-amino-2-deoxy-, 1-(dihydrogen phosphate), monohydrate
• α-D-Galactopyranose, 2-amino-2-deoxy-, 1-(dihydrogen phosphate), hydrate (1:1)

α-D-Galactosamine-1-phosphate

CAS: 75656-33-6

a-D-Galactosamine-1-phosphate is a synthetic, fluorinated glycosylation inhibitor. It inhibits the synthesis of complex carbohydrates and is used in biochemical research. This compound has been shown to inhibit the methylation of glycoproteins and polysaccharides. It also inhibits the phosphorylation of glycogen, which may be useful in cases of diabetes mellitus.

Formula: C₆H₁₄NO₈P

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 259.15 g/mol

Ref: 3D-MG58433