CAS 75667-93-5
:(3-Acetamidoadamantan-1-yl)acetic acid
Description:
(3-Acetamidoadamantan-1-yl)acetic acid, with the CAS number 75667-93-5, is a chemical compound that features a unique structure derived from adamantane, a polycyclic hydrocarbon. This compound contains an acetamido group and an acetic acid moiety, which contribute to its potential biological activity. The presence of the adamantane framework imparts rigidity and stability to the molecule, while the acetamido and acetic acid functional groups enhance its solubility and reactivity in various chemical environments. Typically, compounds like this may exhibit properties such as moderate polarity, which can influence their interactions in biological systems. Additionally, the acetamido group can participate in hydrogen bonding, potentially affecting the compound's pharmacokinetics and pharmacodynamics. Overall, (3-Acetamidoadamantan-1-yl)acetic acid may be of interest in medicinal chemistry and drug design, particularly for its potential therapeutic applications. However, specific biological activities and applications would require further investigation through experimental studies.
Formula:C14H21NO3
InChI:InChI=1S/C14H21NO3/c1-9(16)15-14-5-10-2-11(6-14)4-13(3-10,8-14)7-12(17)18/h10-11H,2-8H2,1H3,(H,15,16)(H,17,18)
SMILES:CC(=NC12CC3CC(CC(C3)(CC(=O)O)C2)C1)O
Synonyms:- [3-(Acetylamino)-1-Adamantyl]Acetic Acid
- (3-Acetylamino-adamantan-1-yl)-acetic acid
- 3-Acetylamino-1-Adamantaneacetic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(3-Acetamidoadamantan-1-Yl)Acetic Acid
CAS:Formula:C14H21NO3Color and Shape:SolidMolecular weight:251.32143-Acetylamino-1-adamantane acetic acid
CAS:3-Acetylamino-1-adamantane acetic acid is an epoxide that is soluble in water. It can be readily prepared from 3-aminoadamantan-1-ol by acylation with acetyl chloride. The yields of the reaction are high, and the product is soluble in water. This compound has a number of analogs that are also soluble in water and isosteric with it. The solubility of these analogs can be enhanced by substituting the amine group with a hydrophilic group such as methyl or carboxylic acid esters. 3-Acetylamino-1-adamantane acetic acid is a polycyclic molecule that contains two epoxide groups and therefore can act as an inhibitor for polycyclic hydrocarbon hydroxylases. It also inhibits the enzyme epoxide hydrolase, which catalyzes the conversion of epoxides to alcohols and oxiranes. InFormula:C14H21NO3Purity:Min. 95%Molecular weight:251.32 g/mol


