CAS 756751-75-4
:1-(3-benzyloxyphenyl)piperazine
Description:
1-(3-Benzyloxyphenyl)piperazine is an organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a benzyloxy group attached to a phenyl ring at the 3-position, contributing to its structural complexity and potential biological activity. The presence of the piperazine moiety often suggests potential pharmacological properties, as piperazine derivatives are known to exhibit various effects on the central nervous system and can act as ligands for neurotransmitter receptors. The benzyloxyphenyl substituent may enhance lipophilicity, influencing the compound's solubility and permeability. Additionally, the compound's molecular structure suggests it may participate in hydrogen bonding and π-π interactions, which can be relevant in drug design and interactions with biological targets. Overall, 1-(3-benzyloxyphenyl)piperazine is of interest in medicinal chemistry, particularly for its potential applications in developing therapeutic agents.
Formula:C17H20N2O
InChI:InChI=1/C17H20N2O/c1-2-5-15(6-3-1)14-20-17-8-4-7-16(13-17)19-11-9-18-10-12-19/h1-8,13,18H,9-12,14H2
SMILES:c1ccc(cc1)COc1cccc(c1)N1CCNCC1
Synonyms:- 1-(3-Benzyloxy-phenyl)-piperazine
- Piperazine, 1-[3-(phenylmethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
