CAS 75679-58-2

1-(2,4-dihydroxy-6-methoxyphenyl)-3-(4-methoxyphenyl)propan-1-one

Description:

1-(2,4-Dihydroxy-6-methoxyphenyl)-3-(4-methoxyphenyl)propan-1-one, with CAS number 75679-58-2, is an organic compound characterized by its complex structure, which includes multiple functional groups. This compound features a propanone backbone, with two aromatic rings substituted with hydroxyl and methoxy groups, contributing to its potential biological activity. The presence of hydroxyl groups suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The methoxy groups can enhance lipophilicity, potentially affecting its pharmacokinetic properties. This compound may be of interest in medicinal chemistry due to its structural motifs, which are often associated with various biological activities, including antioxidant and anti-inflammatory properties. Additionally, its unique arrangement of substituents may allow for interactions with specific biological targets, making it a candidate for further research in drug development or as a biochemical probe. Overall, the characteristics of this compound highlight its potential utility in various chemical and pharmaceutical applications.

Formula: C₁₇H₁₈O₅

InChI: InChI=1/C17H18O5/c1-21-13-6-3-11(4-7-13)5-8-14(19)17-15(20)9-12(18)10-16(17)22-2/h3-4,6-7,9-10,18,20H,5,8H2,1-2H3

SMILES: COc1ccc(cc1)CCC(=O)c1c(cc(cc1OC)O)O

Synonyms:

• 1-(2,4-Dihydroxy-6-methoxy-phenyl)-3-(4-methoxy-phenyl)-propan-1-one
• 1-Propanone, 1-(2,4-Dihydroxy-6-Methoxyphenyl)-3-(4-Methoxyphenyl)-

2,4-Dihydroxy-4,6-dimethoxydihydrochalcone

CAS: 75679-58-2

2,4-Dihydroxy-4,6-dimethoxydihydrochalcone is a natural product for research related to life sciences.

Formula: C₁₇H₁₈O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 302.32

Ref: TM-TN2718

2',4'-Dihydroxy-4,6'-diMethoxydihydrochalcone

CAS: 75679-58-2

Formula: C₁₇H₁₈O₅

Purity: 95%~99%

Molecular weight: 302.326

Ref: BP-BPF7962

2,4-Dihydroxy-4,6-dimethoxydihydrochalcone

CAS: 75679-58-2

2,4-Dihydroxy-4,6-dimethoxydihydrochalcone is a naturally occurring chalcone compound, which is derived from certain plant sources, primarily from the rhizomes of some Alpinia species. This compound is part of the flavonoid family and exhibits significant biological activity due to its specific structural characteristics. The mode of action of 2,4-Dihydroxy-4,6-dimethoxydihydrochalcone involves its interaction with reactive oxygen species, allowing it to scavenge free radicals effectively. This antioxidant activity is primarily attributed to the presence of hydroxyl and methoxy functional groups, which facilitate electron donation and stabilization of free radicals.

Formula: C₁₇H₁₈O₅

Purity: Min. 95%

Molecular weight: 302.32 g/mol

Ref: 3D-ADA67958