CymitQuimica logo

CAS 75680-98-7

:

6-Chloro-1,2,4-triazolo[4,3-b]pyridazine-3-carboxamide

Description:
6-Chloro-1,2,4-triazolo[4,3-b]pyridazine-3-carboxamide is a heterocyclic compound characterized by its unique triazole and pyridazine ring structures. This compound features a chlorine atom at the 6-position of the triazole ring, which can influence its reactivity and biological activity. The carboxamide functional group at the 3-position enhances its solubility in polar solvents and may contribute to its pharmacological properties. Typically, compounds of this nature are investigated for their potential applications in medicinal chemistry, particularly as pharmaceuticals or agrochemicals, due to their ability to interact with biological targets. The presence of both nitrogen and chlorine atoms in the structure can also impart specific electronic properties, making it a subject of interest in various chemical synthesis and drug development studies. As with many heterocycles, the compound's stability, reactivity, and interaction with other molecules can be influenced by its structural features, making it a valuable candidate for further research in the field of organic chemistry.
Formula:C6H4ClN5O
InChI:InChI=1S/C6H4ClN5O/c7-3-1-2-4-9-10-6(5(8)13)12(4)11-3/h1-2H,(H2,8,13)
InChI key:InChIKey=PKAOOSKZFAUEJS-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1N2C(=NN1)C=CC(Cl)=N2
Synonyms:
  • 6-Chloro-1,2,4-triazolo[4,3-b]pyridazine-3-carboxamide
  • 1,2,4-Triazolo[4,3-b]pyridazine-3-carboxamide, 6-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.