CAS 75689-93-9
:Imanixil
Description:
Imanixil, with the CAS number 75689-93-9, is a chemical compound that belongs to the class of substances known as antipsychotics. It is primarily used in the treatment of various psychiatric disorders, including schizophrenia and bipolar disorder. The compound exhibits a unique mechanism of action, often involving the modulation of neurotransmitter systems, particularly dopamine and serotonin receptors, which are crucial in regulating mood and behavior. Imanixil is characterized by its ability to alleviate symptoms of psychosis while minimizing side effects commonly associated with traditional antipsychotic medications. Its pharmacokinetic profile typically includes oral bioavailability and a moderate half-life, allowing for flexible dosing regimens. Additionally, the compound may undergo hepatic metabolism, with potential interactions with other medications. As with any pharmaceutical agent, monitoring for adverse effects and contraindications is essential during treatment. Overall, Imanixil represents a significant advancement in the pharmacological management of mental health disorders, contributing to improved patient outcomes.
Formula:C17H17F3N6O2
InChI:InChI=1/C17H17F3N6O2/c1-16(2)8-26(15(28)25-16)14-22-7-11(12(21)24-14)13(27)23-10-5-3-4-9(6-10)17(18,19)20/h3-7H,8H2,1-2H3,(H,23,27)(H,25,28)(H2,21,22,24)
SMILES:CC1(C)CN(c2ncc(c(=N)[nH]2)C(=Nc2cccc(c2)C(F)(F)F)O)C(=N1)O
Synonyms:- Imanixil [INN]
- 4-Amino-2-(4,4-dimethyl-2-oxo-1-imidazolidinyl)-3'-(trifluyormethyl)-5-pyrimidincarboxanilid
- Imanixilum
- Unii-8892Km4U61
- 4-Amino-2-(4,4-dimethyl-2-oxo-1-imidazolidinyl)-alpha,alpha,alpha-trifluoro-5-pyrimidinecarboxy-m-toluidide
- 4-amino-2-(4,4-dimethyl-2-oxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Amino-3-ethoxybenzenesulfonic acid
CAS:4-Amino-3-ethoxybenzenesulfonic acid is a research tool that is used to study ion channels. It activates the receptor, which leads to increased cell permeability and the release of neurotransmitters. 4-Amino-3-ethoxybenzenesulfonic acid can be used to determine the effects of a ligand on a receptor by binding to it and altering its activity. 4-Amino-3-ethoxybenzenesulfonic acid is also used as an antibody in immunohistochemistry studies and has been shown to inhibit protein interactions.
Formula:C17H17F3N6O2Purity:Min. 95%Molecular weight:394.4 g/molImanixil
CAS:Imanixil boosts LDLR, cuts cholesterol and VLDL production, reducing atherosclerosis.Formula:C17H17F3N6O2Purity:>99.99% - >99.99%Color and Shape:SolidMolecular weight:394.35Ref: TM-T15561
1mg170.00€5mg420.00€10mg620.00€25mg938.00€50mg1,320.00€100mg1,786.00€1mL*10mM (DMSO)430.00€


