CAS 75690-78-7
:N-(2-Phenylethyl)-2-thiophenecarboxamide
Description:
N-(2-Phenylethyl)-2-thiophenecarboxamide, with the CAS number 75690-78-7, is an organic compound characterized by its unique structure that includes a thiophene ring and an amide functional group. This compound typically exhibits a moderate to high degree of lipophilicity due to the presence of the phenyl and thiophene moieties, which can influence its solubility in organic solvents. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of compounds with potential therapeutic effects. The presence of the thiophene ring can contribute to its electronic properties, potentially affecting its reactivity and interaction with biological targets. Additionally, the amide group can participate in hydrogen bonding, which may influence its stability and interactions in various environments. Overall, N-(2-Phenylethyl)-2-thiophenecarboxamide is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its structural features and potential applications.
Formula:C13H13NOS
InChI:InChI=1S/C13H13NOS/c15-13(12-7-4-10-16-12)14-9-8-11-5-2-1-3-6-11/h1-7,10H,8-9H2,(H,14,15)
InChI key:InChIKey=SVHHJXHDSWNWNG-UHFFFAOYSA-N
SMILES:C(NCCC1=CC=CC=C1)(=O)C2=CC=CS2
Synonyms:- N-(2-Phenylethyl)-2-thiophenecarboxamide
- 2-Thiophenecarboxamide, N-(2-phenylethyl)-
- 2-Thiophenecarboxamide, N-phenethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
