
CAS 75693-16-2
:6-Chloro-1,2,3,4-tetrahydro-1-naphthalenol
Description:
6-Chloro-1,2,3,4-tetrahydro-1-naphthalenol, with the CAS number 75693-16-2, is an organic compound characterized by its naphthalene-derived structure, which includes a chloro substituent and a hydroxyl group. This compound features a bicyclic structure that contributes to its unique chemical properties. The presence of the chloro group typically enhances the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The hydroxyl group indicates that it can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. Generally, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. Additionally, the tetrahydro configuration suggests that the compound is saturated, which can affect its stability and reactivity compared to unsaturated analogs. Overall, 6-Chloro-1,2,3,4-tetrahydro-1-naphthalenol is a versatile compound with potential applications in various fields, including organic synthesis and drug development.
Formula:C10H11ClO
InChI:InChI=1S/C10H11ClO/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h4-6,10,12H,1-3H2
InChI key:InChIKey=CCEGQKNJJZETCD-UHFFFAOYSA-N
SMILES:OC1C=2C(=CC(Cl)=CC2)CCC1
Synonyms:- 6-Chloro-1,2,3,4-tetrahydro-1-naphthol
- 1-Naphthalenol, 6-chloro-1,2,3,4-tetrahydro-
- 6-Chloro-1,2,3,4-tetrahydro-1-naphthalenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.