CAS 75693-17-3
:6-bromo-1,2-dihydronaphthalene
Description:
6-Bromo-1,2-dihydronaphthalene is an organic compound characterized by its structure, which features a naphthalene ring system with a bromine substituent at the 6-position and two hydrogen atoms added to the 1 and 2 positions, resulting in a saturated bicyclic compound. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its aromatic properties, which can influence its reactivity and interactions with other chemical species. The presence of the bromine atom introduces both electrophilic and nucleophilic characteristics, making it a useful intermediate in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals. Additionally, 6-bromo-1,2-dihydronaphthalene may exhibit moderate solubility in organic solvents, while its reactivity can be influenced by the bromine substituent, allowing for various substitution reactions. Safety data should be consulted for handling, as halogenated compounds can pose health and environmental risks.
Formula:C10H9Br
InChI:InChI=1/C10H9Br/c11-10-6-5-8-3-1-2-4-9(8)7-10/h2,4-7H,1,3H2
SMILES:C1C=Cc2cc(ccc2C1)Br
Synonyms:- Naphthalene, 6-bromo-1,2-dihydro-
- 6-Bromo-1,2-dihydronaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
