CymitQuimica logo

CAS 75695-99-7

:

3,5-Pyridinedicarboxylic acid, 4-(2,1,3-benzoxadiazol-4-yl)-1,4-dihydro-2,6-dimethyl-, 3-ethyl 5-methyl ester

Description:
3,5-Pyridinedicarboxylic acid, 4-(2,1,3-benzoxadiazol-4-yl)-1,4-dihydro-2,6-dimethyl-, 3-ethyl 5-methyl ester, identified by CAS number 75695-99-7, is a complex organic compound featuring a pyridine ring with two carboxylic acid functional groups and a benzoxadiazole moiety. This compound is characterized by its potential applications in pharmaceuticals and materials science due to its unique structural features, which may impart specific biological or chemical properties. The presence of the dihydro and ester functionalities suggests that it may exhibit interesting reactivity and solubility characteristics. Additionally, the methyl and ethyl substituents on the pyridine ring can influence its lipophilicity and overall stability. The compound's synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further explored through spectroscopic methods such as NMR and mass spectrometry. Overall, this compound represents a class of derivatives that may be of interest for further research in medicinal chemistry and related fields.
Formula:C18H19N3O5
InChI:InChI=1S/C18H19N3O5/c1-5-25-18(23)14-10(3)19-9(2)13(17(22)24-4)15(14)11-7-6-8-12-16(11)21-26-20-12/h6-8,15,19H,5H2,1-4H3
InChI key:InChIKey=JZLLWZJRQZWSRQ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(C(C(OC)=O)=C(C)NC1C)C=2C=3C(C=CC2)=NON3
Synonyms:
  • 3,5-Pyridinedicarboxylic acid, 4-(4-benzofurazanyl)-1,4-dihydro-2,6-dimethyl-, ethyl methyl ester
  • 2,1,3-Benzoxadiazole, 3,5-pyridinedicarboxylic acid deriv.
  • 3,5-Pyridinedicarboxylic acid, 4-(2,1,3-benzoxadiazol-4-yl)-1,4-dihydro-2,6-dimethyl-, ethyl methyl ester
  • 3,5-Pyridinedicarboxylic acid, 4-(2,1,3-benzoxadiazol-4-yl)-1,4-dihydro-2,6-dimethyl-, 3-ethyl 5-methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.