CAS 757-95-9

bis(2,2,2-trifluoroethyl) methylphosphonate

Description:

Bis(2,2,2-trifluoroethyl) methylphosphonate is an organophosphorus compound characterized by its phosphonate functional group, which features a phosphorus atom bonded to an oxygen atom and an alkyl group. This compound is notable for its two trifluoroethyl groups, which contribute to its unique properties, including high thermal stability and low volatility. The presence of fluorine atoms enhances its hydrophobicity and can impart specific biological activity, making it of interest in various applications, including as a potential pesticide or in chemical synthesis. It is typically a colorless liquid at room temperature and may have a distinct odor. The compound is soluble in organic solvents but has limited solubility in water. Safety considerations are important, as organophosphorus compounds can exhibit toxicity, particularly in relation to their effects on the nervous system. Proper handling and storage protocols should be followed to mitigate any risks associated with exposure. Overall, bis(2,2,2-trifluoroethyl) methylphosphonate is a compound of interest in both industrial and research settings due to its unique chemical structure and properties.

Formula: C₅H₇F₆O₃P

InChI: InChI=1/C5H7F6O3P/c1-15(12,13-2-4(6,7)8)14-3-5(9,10)11/h2-3H2,1H3

SMILES: CP(=O)(OCC(F)(F)F)OCC(F)(F)F

Bis(2,2,2-trifluoroethyl) methylphosphonate

CAS: 757-95-9

Formula: C₅H₇F₆O₃P

Purity: 95%

Color and Shape: Liquid

Molecular weight: 260.0715

Ref: IN-DA003O7N

Bis(2,2,2-trifluoroethyl)-Methyl-Phosphonate

CAS: 757-95-9

Formula: C₅H₇F₆O₃P

Molecular weight: 260.07

Ref: 4Z-P-420011

Bis(2,2,2-trifluoroethyl) methylphosphonate

Controlled Product

CAS: 757-95-9

Bis(2,2,2-trifluoroethyl) methylphosphonate is an organic solvent that is a cyclic trisubstituted methylphosphonic acid. It has been used in research as a precursor for other substances and as a reagent for the synthesis of amines. Bis(2,2,2-trifluoroethyl) methylphosphonate is nonflammable and reacts with nucleophiles such as chloride or amines to produce the corresponding phosphonates. The solvents are flammable, so it should be handled with care.

Formula: C₅H₇F₆O₃P

Purity: Min. 95%

Molecular weight: 260.07 g/mol

Ref: 3D-FB87524