CAS 75702-86-2
:1-Cyclopentyl-1H-pyrazol-4-ol
Description:
1-Cyclopentyl-1H-pyrazol-4-ol is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a cyclopentyl group at the 1-position of the pyrazole contributes to its unique properties, including its hydrophobic character and potential for various interactions in biological systems. The hydroxyl group (-OH) at the 4-position enhances its polarity and can participate in hydrogen bonding, influencing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with various biological targets, which could lead to therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, making it important to consider these conditions in experimental settings. Overall, 1-Cyclopentyl-1H-pyrazol-4-ol represents a class of compounds that may have significant implications in pharmacology and organic synthesis.
Formula:C8H12N2O
InChI:InChI=1S/C8H12N2O/c11-8-5-9-10(6-8)7-3-1-2-4-7/h5-7,11H,1-4H2
InChI key:InChIKey=YWCRJNSISFQOCH-UHFFFAOYSA-N
SMILES:OC1=CN(N=C1)C2CCCC2
Synonyms:- 1H-Pyrazol-4-ol, 1-cyclopentyl-
- 1-Cyclopentyl-1H-pyrazol-4-ol
- 1-Cyclopentyl-4-pyrazolol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.