CAS 75703-02-5
:1,1,1-Trifluoro-4-methyl-2-pentanone
Description:
1,1,1-Trifluoro-4-methyl-2-pentanone is a fluorinated ketone characterized by its unique trifluoromethyl group, which significantly influences its chemical properties. This compound features a five-carbon chain with a ketone functional group, making it a member of the ketone family. The presence of three fluorine atoms enhances its polarity and volatility, contributing to its potential applications as a solvent and in organic synthesis. It is typically a colorless liquid at room temperature, exhibiting a distinctive odor. The trifluoromethyl group imparts notable stability and reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and reductions. Additionally, this compound is of interest in the field of materials science and pharmaceuticals due to its unique properties. However, safety considerations are essential, as fluorinated compounds can pose environmental and health risks. Proper handling and disposal methods should be employed to mitigate any potential hazards associated with its use.
Formula:C6H9F3O
InChI:InChI=1S/C6H9F3O/c1-4(2)3-5(10)6(7,8)9/h4H,3H2,1-2H3
InChI key:InChIKey=CBGWZIHLHBYIHY-UHFFFAOYSA-N
SMILES:C(CC(C)C)(C(F)(F)F)=O
Synonyms:- 2-Pentanone, 1,1,1-trifluoro-4-methyl-
- Trifluoromethyl isobutyl ketone
- Isobutyl trifluoromethyl ketone
- 1,1,1-Trifluoro-4-methyl-2-pentanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.