CymitQuimica logo

CAS 75703-25-2

:

(1Z)-2,2,2-trifluoro-N-hydroxy-1-(4-methylphenyl)ethanimine

Description:
(1Z)-2,2,2-Trifluoro-N-hydroxy-1-(4-methylphenyl)ethanimine is a chemical compound characterized by its unique structural features, including a trifluoromethyl group and a hydroxylamine functional group. The presence of the trifluoromethyl group contributes to its lipophilicity and potential reactivity, while the hydroxylamine moiety can participate in various chemical reactions, such as nucleophilic attacks or oxidation processes. The compound also contains a phenyl ring substituted with a methyl group, which can influence its electronic properties and steric hindrance. This compound may exhibit interesting biological activities due to its functional groups, making it a subject of interest in medicinal chemistry and drug development. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions, including pH and temperature. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of fluorine, which can impart toxicity and environmental concerns.
Formula:C9H8F3NO
InChI:InChI=1/C9H8F3NO/c1-6-2-4-7(5-3-6)8(13-14)9(10,11)12/h2-5,14H,1H3/b13-8-
SMILES:Cc1ccc(cc1)/C(=N/O)/C(F)(F)F
Synonyms:
  • (E)-2,2,2-trifluoro-1-p-tolylethanone oxime
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.