CAS 75704-24-4

8,9-Dichloro-2,3,4,4a-tetrahydro-1H-pyrazino[1,2-a]quinoxalin-5(6H)-one

Description:

8,9-Dichloro-2,3,4,4a-tetrahydro-1H-pyrazino[1,2-a]quinoxalin-5(6H)-one is a chemical compound characterized by its complex bicyclic structure, which includes a pyrazinoquinoxaline framework. This compound features two chlorine atoms substituted at the 8 and 9 positions, contributing to its unique reactivity and potential biological activity. The presence of the tetrahydro moiety indicates that it contains a saturated ring system, which can influence its solubility and stability. As a heterocyclic compound, it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The CAS number 75704-24-4 serves as a unique identifier for this substance, facilitating its identification in chemical databases and literature. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be explored for applications in drug development or as a research tool in various biochemical studies. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₁H₁₁Cl₂N₃O

InChI: InChI=1S/C11H11Cl2N3O/c12-6-3-8-9(4-7(6)13)16-2-1-14-5-10(16)11(17)15-8/h3-4,10,14H,1-2,5H2,(H,15,17)

InChI key: InChIKey=PHGWDAICBXUJDU-UHFFFAOYSA-N

SMILES: ClC=1C=C2N3C(C(=O)NC2=CC1Cl)CNCC3

Synonyms:

• 1H-Pyrazino[1,2-a]quinoxalin-5(6H)-one, 8,9-dichloro-2,3,4,4a-tetrahydro-
• 1H-Pyrazino[1,2-a]quinoxalin-5(6H)-one, 8,9-dichloro-2,3,4,4a-tetrahydro-, hydrochloride (1:1)
• 8,9-Dichloro-2,3,4,4a-tetrahydro-1H-pyrazino[1,2-a]quinoxalin-5(6H)-one
• Way 161503
• 8,9-Dichloro-2,3,4,4a-tetrahydro-1H-pyrazino[1,2-a]quinoxalin-5(6H)-one hydrochloride (1:1)

(Rac)-WAY-161503

CAS: 75704-24-4

(Rac)-WAY-161503

Purity: ≥98%

Molecular weight: 272.13g/mol

Ref: 54-BUP06189

(Rac)-WAY-161503

CAS: 75704-24-4

(Rac)-WAY-161503 is a selective and high-affinity agonist of the 5-HT2C receptor (Ki: 4 nM; EC50: 12 nM), with anti-obesity and antidepressant effects.

Formula: C₁₁H₁₁Cl₂N₃O

Purity: 99.51%

Color and Shape: Solid

Molecular weight: 272.13

Ref: TM-T13332