CAS 75708-29-1

1-(3-{[2-hydroxy-3-(naphthalen-1-yloxy)propyl]amino}-3-methylbutyl)-1,3-dihydro-2H-benzimidazol-2-one hydrochloride hydrate

Description:

1-(3-{[2-hydroxy-3-(naphthalen-1-yloxy)propyl]amino}-3-methylbutyl)-1,3-dihydro-2H-benzimidazol-2-one hydrochloride hydrate, with CAS number 75708-29-1, is a chemical compound characterized by its complex structure, which includes a benzimidazole core, a naphthalenyl moiety, and a hydroxypropyl side chain. This compound typically exhibits properties associated with both benzimidazole derivatives and amine functionalities, such as potential biological activity, including antimicrobial or anticancer effects. The presence of the hydrochloride salt form suggests enhanced solubility in aqueous environments, which is often beneficial for pharmacological applications. The hydrate form indicates that the compound can incorporate water molecules into its crystalline structure, which may influence its stability and solubility. Overall, this compound's unique structural features contribute to its potential utility in medicinal chemistry and drug development, although specific biological activities and mechanisms would require further investigation through empirical studies.

Formula: C₂₅H₃₂ClN₃O₄

InChI: InChI=1/C25H29N3O3.ClH.H2O/c1-25(2,14-15-28-22-12-6-5-11-21(22)27-24(28)30)26-16-19(29)17-31-23-13-7-9-18-8-3-4-10-20(18)23;;/h3-13,19,26,29H,14-17H2,1-2H3,(H,27,30);1H;1H2

SMILES: CC(C)(CCn1c2ccccc2nc1O)NCC(COc1cccc2ccccc12)O.Cl.O

Adimolol

Controlled Product

CAS: 75708-29-1

Formula: C₂₅H₂₉N₃O₃·ClH

Color and Shape: Neat

Molecular weight: 455.977

Ref: TR-A291575

MEN935

CAS: 75708-29-1

MEN935 is an antihypertensive agent. It is also a β-adrenoceptor blocker.

Formula: C₂₅H₃₀ClN₃O₃

Color and Shape: Solid

Molecular weight: 455.98

Ref: TM-T24448