CAS 75715-99-0

3-Azabicyclo[3.1.0]hexane-2-carboxylic acid, ethyl ester

Description:

3-Azabicyclo[3.1.0]hexane-2-carboxylic acid, ethyl ester, is a bicyclic compound characterized by its unique structure, which includes a nitrogen atom incorporated into a bicyclic framework. This compound features a carboxylic acid functional group esterified with an ethyl group, contributing to its reactivity and potential applications in organic synthesis. The bicyclic structure imparts rigidity and can influence the compound's physical properties, such as boiling and melting points, solubility, and stability. Typically, such compounds may exhibit interesting biological activities, making them of interest in medicinal chemistry. The presence of the azabicyclic moiety can also affect the compound's interaction with biological targets, potentially leading to pharmacological effects. As with many organic compounds, the specific characteristics, including reactivity and stability, can be influenced by environmental factors such as pH and temperature. Overall, 3-Azabicyclo[3.1.0]hexane-2-carboxylic acid, ethyl ester, represents a class of compounds with diverse applications in chemical research and development.

Formula: C₈H₁₃NO₂

InChI: InChI=1S/C8H13NO2/c1-2-11-8(10)7-6-3-5(6)4-9-7/h5-7,9H,2-4H2,1H3

InChI key: InChIKey=QJFZMDWMBRUEMA-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1C2C(C2)CN1

Synonyms:

• 3-Azabicyclo[3.1.0]hexane-2-carboxylic acid, ethyl ester
• Ethyl 3-azabicyclo[3.1.0]hexane-2-carboxylate
• 3-Azabicyclo[3.1.0]hexane-2-carboxylicacid,ethylester(9CI)