CymitQuimica logo

CAS 757192-78-2

:

7-Chloro-2,3-dihydro-3-pentyl-2-thioxo-4(1H)-quinazolinone

Description:
7-Chloro-2,3-dihydro-3-pentyl-2-thioxo-4(1H)-quinazolinone is a chemical compound characterized by its quinazolinone core structure, which features a thioxo group (a sulfur atom double-bonded to a carbon atom) and a chlorine substituent. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural features. The presence of the pentyl group contributes to its hydrophobic characteristics, which may influence its solubility and interaction with biological membranes. The chlorine atom can enhance the compound's reactivity and may play a role in its pharmacological properties. As a thioxo derivative, it may also exhibit unique chemical reactivity, particularly in nucleophilic substitution reactions. Overall, this compound is of interest in medicinal chemistry and may be investigated for its potential therapeutic applications, although specific biological activities and mechanisms would require further empirical study.
Formula:C13H15ClN2OS
InChI:InChI=1S/C13H15ClN2OS/c1-2-3-4-7-16-12(17)10-6-5-9(14)8-11(10)15-13(16)18/h5-6,8H,2-4,7H2,1H3,(H,15,18)
InChI key:InChIKey=BUCJWRUYMPCNNO-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(=S)N1CCCCC)=CC(Cl)=CC2
Synonyms:
  • 4(1H)-Quinazolinone, 7-chloro-2,3-dihydro-3-pentyl-2-thioxo-
  • 7-Chloro-2,3-dihydro-3-pentyl-2-thioxo-4(1H)-quinazolinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.