CAS 757239-67-1

tert-butyl 4-hydroxy-1-oxa-8-azaspiro[4.5]decane-8-carboxylate

Description:

Tert-butyl 4-hydroxy-1-oxa-8-azaspiro[4.5]decane-8-carboxylate, with the CAS number 757239-67-1, is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom in a bicyclic framework. This compound features a tert-butyl group, which contributes to its hydrophobic properties, and a carboxylate functional group that can participate in various chemical reactions, such as esterification or nucleophilic substitution. The presence of the hydroxy group indicates potential for hydrogen bonding, which can influence its solubility and reactivity. The oxo and azaspiro components suggest that this compound may exhibit interesting biological activity, making it a candidate for pharmaceutical applications. Its structural complexity may also lead to unique physical properties, such as melting point and solubility, which are important for its practical use. Overall, the combination of these functional groups and structural features makes tert-butyl 4-hydroxy-1-oxa-8-azaspiro[4.5]decane-8-carboxylate a compound of interest in both synthetic and medicinal chemistry.

Formula: C₁₃H₂₃NO₄

InChI: InChI=1/C13H23NO4/c1-12(2,3)18-11(16)14-7-5-13(6-8-14)10(15)4-9-17-13/h10,15H,4-9H2,1-3H3

SMILES: CC(C)(C)OC(=O)N1CCC2(CC1)C(CCO2)O

Synonyms:

• tert-Butyl-4-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-carboxylat

tert-butyl 4-hydroxy-1-oxa-8-azaspiro[4.5]decane-8-carboxylate

CAS: 757239-67-1

tert-butyl 4-hydroxy-1-oxa-8-azaspiro[4.5]decane-8-carboxylate

Purity: 98%

Ref: 54-OR1042219

tert-Butyl 4-hydroxy-1-oxa-8-azaspiro[4.5]decane-8-carboxylate

CAS: 757239-67-1

Purity: 98%

Molecular weight: 257.16

Ref: 10-F567746

tert-Butyl 4-Hydroxy-1-oxa-8-azaspiro[4.5]decane-8-carboxylate

Controlled Product

CAS: 757239-67-1

Formula: C₁₃H₂₃NO₄

Color and Shape: Neat

Molecular weight: 257.326

Ref: TR-B704930