
CAS 757239-68-2
:1-Oxa-8-azaspiro[4.5]decan-4-ol
Description:
1-Oxa-8-azaspiro[4.5]decan-4-ol is a chemical compound characterized by its unique spirocyclic structure, which includes both an oxygen atom and a nitrogen atom within its framework. This compound features a bicyclic system that contributes to its potential biological activity and chemical reactivity. The presence of the hydroxyl (-OH) group indicates that it is an alcohol, which can participate in hydrogen bonding, influencing its solubility and reactivity. The spiro structure often imparts rigidity to the molecule, which can affect its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's specific stereochemistry can play a crucial role in its pharmacological properties. As with many nitrogen-containing heterocycles, it may exhibit various biological activities, including antimicrobial or anti-inflammatory effects, although specific studies would be necessary to confirm these properties. Overall, 1-Oxa-8-azaspiro[4.5]decan-4-ol represents a class of compounds that are valuable in the development of new therapeutic agents.
Formula:C8H15NO2
InChI:InChI=1S/C8H15NO2/c10-7-1-6-11-8(7)2-4-9-5-3-8/h7,9-10H,1-6H2
InChI key:InChIKey=KUEFHUPQKWILNE-UHFFFAOYSA-N
SMILES:OC1C2(OCC1)CCNCC2
Synonyms:- 1-Oxa-8-azaspiro[4.5]decan-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.