CAS 75724-98-0
:bromo-(2,3,5,6-tetramethylphenyl)magnesium
Description:
Bromo-(2,3,5,6-tetramethylphenyl)magnesium, with the CAS number 75724-98-0, is an organomagnesium compound that belongs to the class of Grignard reagents. These compounds are characterized by the presence of a carbon-magnesium bond, which is highly reactive and plays a crucial role in organic synthesis. The specific structure of this compound features a bromo-substituted aromatic ring with four methyl groups, contributing to its steric bulk and electronic properties. As a Grignard reagent, it is typically used in nucleophilic addition reactions, allowing for the formation of carbon-carbon bonds. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in the synthesis of various organic compounds. However, due to its reactivity, particularly with moisture and air, it must be handled under anhydrous conditions. Overall, bromo-(2,3,5,6-tetramethylphenyl)magnesium is a valuable reagent in synthetic organic chemistry, facilitating the construction of complex molecular architectures.
Formula:C10H13BrMg
InChI:InChI=1/C10H13.BrH.Mg/c1-7-5-9(3)10(4)6-8(7)2;;/h5H,1-4H3;1H;/q;;+1/p-1/rC10H13BrMg/c1-6-5-7(2)9(4)10(12-11)8(6)3/h5H,1-4H3
SMILES:CC1=CC(C)C(=C=C1C)C.Br.[Mg]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.