CymitQuimica logo

CAS 757247-93-1

:

Benzonitrile,4-amino-2-fluoro-3-methyl-

Description:
Benzonitrile, 4-amino-2-fluoro-3-methyl- is an organic compound characterized by the presence of a benzonitrile group, which consists of a phenyl ring attached to a nitrile (–C≡N) functional group. The compound features an amino group (–NH2) and a fluoro group (–F) on the aromatic ring, specifically at the 4 and 2 positions, respectively, along with a methyl group (–CH3) at the 3 position. This substitution pattern contributes to its unique chemical properties, including its potential reactivity and solubility characteristics. The presence of the nitrile group typically imparts polar characteristics, making the compound soluble in polar solvents. Additionally, the amino group can participate in hydrogen bonding, influencing its interactions in various chemical environments. Benzonitrile derivatives are often studied for their applications in pharmaceuticals and agrochemicals due to their biological activity and ability to serve as intermediates in synthetic pathways. Overall, this compound exemplifies the complexity and versatility of substituted benzonitriles in organic chemistry.
Formula:C8H7FN2
InChI:InChI=1S/C8H7FN2/c1-5-7(11)3-2-6(4-10)8(5)9/h2-3H,11H2,1H3
InChI key:GTAKXKONKSMWLZ-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1F)C#N)N
Synonyms:
  • Benzonitrile, 4-amino-2-fluoro-3-methyl- (9CI)
Found 4 products.