CAS 75726-96-4

2-bromo-N-(propan-2-yl)acetamide

Description:

2-bromo-N-(propan-2-yl)acetamide, with the CAS number 75726-96-4, is an organic compound characterized by the presence of a bromine atom, an acetamide functional group, and an isopropyl substituent. This compound features a bromo group attached to the second carbon of the acetamide structure, which contributes to its reactivity and potential applications in organic synthesis. The isopropyl group enhances the steric bulk around the nitrogen atom, influencing its chemical behavior and interactions. Typically, compounds like this exhibit moderate solubility in polar solvents due to the presence of the amide functional group, while the bromine atom can participate in nucleophilic substitution reactions. The presence of the bromine atom also suggests potential use in various chemical transformations, including coupling reactions and as a building block in the synthesis of more complex molecules. Overall, 2-bromo-N-(propan-2-yl)acetamide is of interest in medicinal chemistry and synthetic organic chemistry due to its unique structural features and reactivity.

Formula: C₅H₁₀BrNO

InChI: InChI=1/C5H10BrNO/c1-4(2)7-5(8)3-6/h4H,3H2,1-2H3,(H,7,8)

SMILES: CC(C)N=C(CBr)O

Synonyms:

• 2-Bromo-N-isopropylacetamide
• acetamide, 2-bromo-N-(1-methylethyl)-

2-Bromo-N-isopropylacetamide

CAS: 75726-96-4

Formula: C₅H₁₀BrNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 180.0430

Ref: IN-DA0038G7

2-Bromo-N-isopropylacetamide

CAS: 75726-96-4

2-Bromo-N-isopropylacetamide

Purity: 98%

Molecular weight: 180.04g/mol

Ref: 54-OR916782

2-Bromo-N-isopropylacetamide

CAS: 75726-96-4

Formula: C₅H₁₀BrNO

Purity: 98%

Color and Shape: Solid, White powder

Molecular weight: 180.045

Ref: 10-F229089