CymitQuimica logo

CAS 75727-47-8

:

5-(4-methylpiperazin-1-yl)-5-oxopentanoic acid

Description:
5-(4-Methylpiperazin-1-yl)-5-oxopentanoic acid, with the CAS number 75727-47-8, is a chemical compound characterized by its unique structure that includes a piperazine ring and a pentanoic acid moiety. This compound typically exhibits properties associated with both amines and carboxylic acids, which can influence its solubility and reactivity. The presence of the piperazine ring suggests potential applications in pharmaceuticals, particularly in drug design, due to its ability to interact with biological targets. The oxo group in the pentanoic acid portion may contribute to its reactivity, allowing for various chemical transformations. Additionally, the methyl group on the piperazine ring can affect the compound's steric and electronic properties, potentially enhancing its biological activity. Overall, this compound's characteristics make it of interest in medicinal chemistry and related fields, where its structural features may be leveraged for developing therapeutic agents.
Formula:C10H18N2O3
InChI:InChI=1/C10H18N2O3/c1-11-5-7-12(8-6-11)9(13)3-2-4-10(14)15/h2-8H2,1H3,(H,14,15)
SMILES:CN1CCN(CC1)C(=O)CCCC(=O)O
Synonyms:
  • 1-Piperazinepentanoic acid, 4-methyl-delta-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.