CAS 75731-44-1

(3-Methoxyphenyl)(4-methoxyphenyl)methanone

Description:

(3-Methoxyphenyl)(4-methoxyphenyl)methanone, also known by its CAS number 75731-44-1, is an organic compound characterized by its structure, which features two methoxy-substituted phenyl groups attached to a central carbonyl group (ketone). This compound typically appears as a solid at room temperature and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic aromatic rings. The presence of methoxy groups enhances its electron-donating properties, which can influence its reactivity and interaction with other chemical species. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and material science. Its synthesis often involves the reaction of appropriate phenolic precursors with carbonyl compounds, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₁₅H₁₄O₃

InChI: InChI=1S/C15H14O3/c1-17-13-8-6-11(7-9-13)15(16)12-4-3-5-14(10-12)18-2/h3-10H,1-2H3

InChI key: InChIKey=XSUJSUIVBJPHFR-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(OC)=CC=C1)C2=CC=C(OC)C=C2

Synonyms:

• (3-Methoxyphenyl)(4-methoxyphenyl)methanone
• 3,4′-Dimethoxybenzophenone
• Benzophenone, 3,4′-dimethoxy-
• Methanone, (3-methoxyphenyl)(4-methoxyphenyl)-