CAS 75735-47-6
:Methyl 4-methyl-5-nitro-2-thiophenecarboxylate
Description:
Methyl 4-methyl-5-nitro-2-thiophenecarboxylate, with the CAS number 75735-47-6, is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features a methyl group and a nitro group at specific positions on the thiophene ring, contributing to its chemical reactivity and potential applications in organic synthesis. The presence of the carboxylate functional group indicates that it can participate in various chemical reactions, such as esterification and nucleophilic substitutions. Methyl 4-methyl-5-nitro-2-thiophenecarboxylate is typically a yellow to orange solid or liquid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it useful in various chemical processes. The nitro group enhances its electrophilic character, making it a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Safety data should be consulted for handling and storage, as nitro compounds can be sensitive to heat and shock.
Formula:C7H7NO4S
InChI:InChI=1S/C7H7NO4S/c1-4-3-5(7(9)12-2)13-6(4)8(10)11/h3H,1-2H3
InChI key:InChIKey=ZMPNEFDRDQESSG-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1SC(N(=O)=O)=C(C)C1
Synonyms:- Methyl 4-methyl-5-nitro-2-thiophenecarboxylate
- 2-Thiophenecarboxylic acid, 4-methyl-5-nitro-, methyl ester
- Methyl 4-Methyl-5-nitrothiophene-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
