CAS 75737-39-2
:N-(3-methoxybenzyl)-5H-purin-6-amine
Description:
N-(3-methoxybenzyl)-5H-purin-6-amine, with the CAS number 75737-39-2, is a purine derivative characterized by its structural features that include a purine core substituted with a 3-methoxybenzyl group at the nitrogen position. This compound typically exhibits properties common to purines, such as being a heterocyclic aromatic compound, which may contribute to its biological activity. The presence of the methoxy group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. Additionally, the benzyl substitution can affect its interaction with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit various biological activities, including potential roles in cellular signaling or as an enzyme inhibitor, although specific biological data would depend on empirical studies. As with many organic compounds, its stability, reactivity, and interactions with other molecules can be influenced by environmental conditions such as pH and temperature.
Formula:C13H13N5O
InChI:InChI=1/C13H13N5O/c1-19-10-4-2-3-9(5-10)6-14-12-11-13(16-7-15-11)18-8-17-12/h2-5,7-8,11H,6H2,1H3,(H,14,15,16,17,18)
SMILES:COc1cccc(c1)CN=C1C2C(=NC=N2)NC=N1
Synonyms:- 6-(3-Methoxybenzylamino)Purine
- meta-METHOXYTOPOLIN (MemT)
- MemT
- 9H-Purin-6-amine, N-[(3-methoxyphenyl)methyl]-
- NSC 145023
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
