CAS 75737-41-6
:N-(2-methoxybenzyl)-5H-purin-6-amine
Description:
N-(2-methoxybenzyl)-5H-purin-6-amine, with the CAS number 75737-41-6, is a purine derivative characterized by its structural features that include a purine core substituted with a 2-methoxybenzyl group at the nitrogen position. This compound typically exhibits properties associated with purines, such as potential biological activity, particularly in relation to nucleic acid metabolism and signaling pathways. It may possess moderate solubility in organic solvents and exhibit varying degrees of stability depending on environmental conditions. The presence of the methoxy group can influence its lipophilicity and reactivity, potentially enhancing its interaction with biological targets. Additionally, compounds of this nature are often studied for their pharmacological properties, including anti-cancer and anti-inflammatory effects. As with many purine derivatives, the compound may also be of interest in medicinal chemistry for the development of therapeutic agents. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical determination or literature reference for precise values.
Formula:C13H13N5O
InChI:InChI=1/C13H13N5O/c1-19-10-5-3-2-4-9(10)6-14-12-11-13(16-7-15-11)18-8-17-12/h2-5,7-8,11H,6H2,1H3,(H,14,15,16,17,18)
SMILES:COc1ccccc1CN=C1C2C(=NC=N2)NC=N1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.