CymitQuimica logo

CAS 75744-53-5

:

2-[(Tetrahydro-2H-pyran-2-yl)oxy]-1-propanamine

Description:
2-[(Tetrahydro-2H-pyran-2-yl)oxy]-1-propanamine, with the CAS number 75744-53-5, is an organic compound characterized by its amine functional group and a tetrahydropyran moiety. This compound features a propanamine backbone, which contributes to its basicity and potential reactivity in various chemical reactions. The presence of the tetrahydro-2H-pyran ring introduces a cyclic ether structure, enhancing its stability and influencing its solubility properties. Typically, compounds of this nature exhibit moderate polarity due to the combination of hydrophilic amine and ether functionalities, making them soluble in polar solvents. Additionally, the compound may participate in hydrogen bonding, which can affect its boiling and melting points. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where such compounds can serve as intermediates or active pharmaceutical ingredients. Overall, the unique combination of functional groups in 2-[(Tetrahydro-2H-pyran-2-yl)oxy]-1-propanamine contributes to its chemical behavior and potential utility in various fields.
Formula:C8H17NO2
InChI:InChI=1S/C8H17NO2/c1-7(6-9)11-8-4-2-3-5-10-8/h7-8H,2-6,9H2,1H3
InChI key:InChIKey=YBIUTDSUHGIFCZ-UHFFFAOYSA-N
SMILES:O(C(CN)C)C1CCCCO1
Synonyms:
  • 2-[(Tetrahydro-2H-pyran-2-yl)oxy]-1-propanamine
  • 2-[(1-Aminopropan-2-yl)oxy]oxane
  • 2-(Oxan-2-yloxy)propan-1-amine
  • 1-Propanamine, 2-[(tetrahydro-2H-pyran-2-yl)oxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.