CAS 75746-71-3

2-ethyl-6-methylphenyl isocyanate

Description:

2-Ethyl-6-methylphenyl isocyanate, with the CAS number 75746-71-3, is an organic compound characterized by the presence of an isocyanate functional group (-N=C=O) attached to a substituted aromatic ring. This compound typically exhibits a yellow to amber color and has a distinct, pungent odor. It is a liquid at room temperature and is known for its reactivity, particularly with nucleophiles, making it useful in the synthesis of various organic compounds, including pharmaceuticals and agrochemicals. The presence of the ethyl and methyl groups on the phenyl ring influences its physical and chemical properties, such as solubility and boiling point. Additionally, 2-ethyl-6-methylphenyl isocyanate is considered hazardous, as isocyanates are known to be irritants and can pose health risks upon exposure. Proper handling and safety precautions are essential when working with this compound in laboratory or industrial settings.

Formula: C₁₀H₁₁NO

InChI: InChI=1/C10H11NO/c1-3-9-6-4-5-8(2)10(9)11-7-12/h4-6H,3H2,1-2H3

SMILES: CCc1cccc(C)c1N=C=O

Synonyms:

• 1-Ethyl-2-Isocyanato-3-Methylbenzene

2-Ethyl-6-methylphenyl isocyanate

CAS: 75746-71-3

Formula: C₁₀H₁₁NO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 161.2004

Ref: IN-DA003H7A

2-Ethyl-6-methylphenyl isocyanate

CAS: 75746-71-3

2-Ethyl-6-methylphenyl isocyanate

Formula: C₁₀H₁₁NO

Purity: 95%

Color and Shape: clear. colourless liquid

Molecular weight: 161.20g/mol

Ref: 54-OR0473