CAS 75747-77-2
:dichlorotetrakis[N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]-1H-imidazole-1-carboxamide]manganese
Description:
Dichlorotetrakis[N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]-1H-imidazole-1-carboxamide]manganese, with CAS number 75747-77-2, is a complex chemical compound that features a manganese center coordinated with multiple ligands. The structure includes imidazole derivatives, which are known for their biological activity and potential applications in medicinal chemistry. The presence of the trichlorophenoxy group suggests that the compound may exhibit herbicidal or pesticidal properties, as chlorinated phenoxy compounds are often associated with such activities. The manganese ion typically plays a role in redox reactions and can be involved in various catalytic processes. This compound may also exhibit unique solubility and stability characteristics due to its complex structure. Its potential applications could span across fields such as agriculture, biochemistry, and materials science, although specific biological or chemical properties would require further investigation through empirical studies. Safety and handling precautions should be observed due to the presence of chlorine and the potential toxicity associated with some of its components.
Formula:C60H64Cl14MnN12O8
InChI:InChI=1/C15H16Cl3N3O2.Mn/c1-2-4-20(15(22)21-5-3-19-10-21)6-7-23-14-12(17)8-11(16)9-13(14)18;/h3,5,8-10H,2,4,6-7H2,1H3;/q;+2
InChI key:InChIKey=OXOKTPUZOHPXSA-UHFFFAOYSA-L
SMILES:[Mn+2](O=C(N(CCOC1=C(Cl)C=C(Cl)C=C1Cl)CCC)N2C=CN=C2)(O=C(N(CCOC3=C(Cl)C=C(Cl)C=C3Cl)CCC)N4C=CN=C4)(O=C(N(CCOC5=C(Cl)C=C(Cl)C=C5Cl)CCC)N6C=CN=C6)(O=C(N(CCOC7=C(Cl)C=C(Cl)C=C7Cl)CCC)N8C=CN=C8)([Cl-])[Cl-]
Synonyms:- Manganese, dichlorotetrakis[N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]-1H-imidazole-1-carboxamide-κO1]-
- 1H-Imidazole-1-carboxamide, N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]-, manganese complex
- Prochloraz manganese chloride complex
- Dichlorotetrakis[N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]-1H-imidazole-1-carboxamide-κO1]manganese
- Prochloraz manganese(II) complex (4:1)
- dichlorotetrakis(n-propyl-n-(2-(2,4,6-trichlorophenoxy)ethyl)-1h-imidazole-1-carboxamide)manganese
- Prochloraz manganese
- Prochloraz, manganese complex
- Manganese, dichlorotetrakisN-propyl-N-2-(2,4,6-trichlorophenoxy)ethyl-1H-imidazole-1-carboxamide-
- Manganese,dichlorotetrakis[N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]-1H-iMidazole-1-carboxaMide]-(9CI)
- prochloraz manganese II chloride complex
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Prochloraz manganese (Standard)
CAS:Prochloraz manganese (Standard) is the standard substance of Prochloraz manganese, and it is applicable for quantitative analysis, quality control, and related research in biochemical experiments. Prochloraz manganese, an antifungal agent utilized in the agricultural sectors , serves to protect crops by inhibiting fungal growth.Formula:C60H64Cl14MnN12O8Molecular weight:1632.51Prochloraz Manganese Chloride Complex
CAS:Controlled Product<p>Applications Prochloraz Manganese Chloride Complex can be used in biological study of pathogen identification of a new disease in Siraitia grosvenorii and screening of effective fungicides.<br>References Jiang, N., et al.: Zhiwu Baohu, 41, 173 (2015)<br></p>Formula:C60H64Cl14MnN12O8Color and Shape:White SolidMolecular weight:1632.51Prochloraz manganese
CAS:<p>Prochloraz manganese, an antifungal agent utilized in the agricultural sectors [1], serves to protect crops by inhibiting fungal growth.</p>Formula:C60H64Cl14MnN12O8Color and Shape:SolidMolecular weight:1632.51


