CAS 7575-74-8
:2-[1-(4-chlorophenyl)ethylidene]hydrazinecarboxamide
Description:
2-[1-(4-Chlorophenyl)ethylidene]hydrazinecarboxamide, with the CAS number 7575-74-8, is a chemical compound characterized by its hydrazinecarboxamide functional group and a substituted ethylidene moiety. This compound typically exhibits properties associated with hydrazine derivatives, including potential biological activity, which may include antimicrobial or anticancer effects. The presence of the 4-chlorophenyl group suggests that it may have enhanced lipophilicity, potentially influencing its solubility and interaction with biological membranes. The compound's structure indicates it may participate in hydrogen bonding due to the amide functional group, which can affect its reactivity and stability. Additionally, the chlorinated aromatic ring may contribute to the compound's electronic properties, impacting its reactivity in various chemical reactions. Overall, 2-[1-(4-chlorophenyl)ethylidene]hydrazinecarboxamide is of interest in medicinal chemistry and may serve as a lead compound for further pharmacological studies.
Formula:C9H10ClN3O
InChI:InChI=1/C9H10ClN3O/c1-6(12-13-9(11)14)7-2-4-8(10)5-3-7/h2-5H,1H3,(H3,11,13,14)
SMILES:CC(=NNC(=N)O)c1ccc(cc1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.