CAS 7575-89-5
:(2R)-1,2,3,4-Tetrahydro-2-naphthalenol
Description:
(2R)-1,2,3,4-Tetrahydro-2-naphthalenol, with the CAS number 7575-89-5, is an organic compound characterized by its bicyclic structure, which consists of a naphthalene ring system that has undergone partial hydrogenation. This results in a saturated, cyclic compound featuring a hydroxyl (-OH) group attached to the second carbon of the naphthalene framework. The "2R" designation indicates the specific stereochemistry of the molecule, which is crucial for its biological activity and interactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents and exhibits moderate polarity due to the presence of the hydroxyl group. (2R)-1,2,3,4-Tetrahydro-2-naphthalenol has potential applications in organic synthesis and may serve as a precursor or intermediate in the production of various pharmaceuticals and fine chemicals. Its unique structural features contribute to its reactivity and potential use in medicinal chemistry.
Formula:C10H12O
InChI:InChI=1S/C10H12O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-4,10-11H,5-7H2/t10-/m1/s1
InChI key:InChIKey=JWQYZECMEPOAPF-SNVBAGLBSA-N
SMILES:O[C@H]1CC=2C(CC1)=CC=CC2
Synonyms:- 2-Naphthalenol, 1,2,3,4-tetrahydro-, (R)-
- (2R)-1,2,3,4-Tetrahydro-2-naphthalenol
- 2-Naphthol, 1,2,3,4-tetrahydro-, (R)-(+)-
- (R)-1,2,3,4-Tetrahydro-2-naphthol
- 2-Naphthalenol, 1,2,3,4-tetrahydro-, (2R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.