CAS 75751-72-3

2-azaspiro[4.4]nonan-3-one

Description:

2-Azaspiro[4.4]nonan-3-one, with the CAS number 75751-72-3, is a bicyclic compound featuring a spiro structure that incorporates a nitrogen atom within its framework. This compound is characterized by its unique spirocyclic arrangement, which contributes to its potential biological activity and chemical reactivity. The presence of a carbonyl group (ketone) at the 3-position enhances its reactivity, making it a valuable intermediate in organic synthesis. The nitrogen atom in the azaspiro structure can influence the compound's properties, such as solubility and polarity, which are critical for its application in medicinal chemistry and drug design. Additionally, the compound may exhibit interesting stereochemical properties due to its spiro configuration, which can affect its interaction with biological targets. Overall, 2-azaspiro[4.4]nonan-3-one represents a class of compounds that are of interest for their potential applications in pharmaceuticals and materials science, owing to their unique structural features and reactivity.

Formula: C₈H₁₃NO

InChI: InChI=1/C8H13NO/c10-7-5-8(6-9-7)3-1-2-4-8/h1-6H2,(H,9,10)

SMILES: C1CCC2(C1)CC(=NC2)O

2-Azaspiro[4.4]nonan-3-one

CAS: 75751-72-3

Formula: C₈H₁₃NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 139.1949

Ref: IN-DA005UZE

2-Azaspiro[4.4]nonan-3-one

CAS: 75751-72-3

2-Azaspiro[4.4]nonan-3-one

Purity: 98%

Molecular weight: 139.19g/mol

Ref: 54-OR33313

2-azaspiro[4.4]nonan-3-one

CAS: 75751-72-3

Formula: C₈H₁₃NO

Purity: 98%

Color and Shape: Solid, Crystalline

Molecular weight: 139.198

Ref: 10-F310399