CAS 75762-56-0

(3-bromophenyl)(4-chlorophenyl)methanone

Description:

(3-bromophenyl)(4-chlorophenyl)methanone, also known by its CAS number 75762-56-0, is an organic compound characterized by the presence of a ketone functional group attached to two aromatic rings. The structure features a methanone (or ketone) moiety where one phenyl ring is substituted with a bromine atom at the meta position (3-bromo) and the other with a chlorine atom at the para position (4-chloro). This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its aromatic nature. Its molecular structure contributes to its potential reactivity, particularly in electrophilic aromatic substitution reactions. The presence of halogen substituents can influence the electronic properties of the compound, affecting its reactivity and interactions with other chemical species. Additionally, such compounds may have applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, owing to their unique structural characteristics and reactivity profiles.

Formula: C₁₃H₈BrClO

InChI: InChI=1/C13H8BrClO/c14-11-3-1-2-10(8-11)13(16)9-4-6-12(15)7-5-9/h1-8H

SMILES: c1cc(cc(c1)Br)C(=O)c1ccc(cc1)Cl

Synonyms:

• Methanone, (3-bromophenyl)(4-chlorophenyl)-
• (3-Bromophenyl)(4-chlorophenyl)methanone