CymitQuimica logo

CAS 75762-58-2

:

(3-Bromophenyl)(3-fluorophenyl)methanone

Description:
(3-Bromophenyl)(3-fluorophenyl)methanone, with the CAS number 75762-58-2, is an organic compound characterized by the presence of both bromine and fluorine substituents on phenyl rings attached to a central carbonyl group (ketone). This compound typically exhibits a solid state at room temperature and is likely to be a white to off-white crystalline substance. The presence of the bromine and fluorine atoms contributes to its unique electronic properties, potentially enhancing its reactivity and influencing its interactions in chemical reactions. The compound may be soluble in organic solvents, such as dichloromethane or acetone, but is generally insoluble in water due to its hydrophobic nature. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Additionally, the specific arrangement of substituents can affect its biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C13H8BrFO
InChI:InChI=1S/C13H8BrFO/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H
InChI key:InChIKey=KGAQUGKHKYDPDW-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Br)=CC=C1)C2=CC(F)=CC=C2
Synonyms:
  • (3-Bromophenyl)(3-fluorophenyl)methanone
  • Methanone, (3-bromophenyl)(3-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.