CAS 75762-59-3
:(3-bromophenyl)(3-chlorophenyl)methanone
Description:
(3-bromophenyl)(3-chlorophenyl)methanone, with the CAS number 75762-59-3, is an organic compound characterized by the presence of both bromine and chlorine substituents on a phenyl ring, attached to a carbonyl group (ketone). This compound features a central carbon atom bonded to a carbonyl group (C=O) and two aromatic rings: one containing a bromine atom and the other containing a chlorine atom, both located at the meta position relative to the carbonyl group. The presence of these halogen substituents can influence the compound's reactivity, stability, and solubility, often enhancing its electrophilic character. The compound may exhibit interesting properties such as potential biological activity, making it of interest in medicinal chemistry and materials science. Its synthesis typically involves electrophilic aromatic substitution reactions, and it can be analyzed using techniques like NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, this compound represents a class of halogenated ketones that can serve as intermediates in various chemical syntheses.
Formula:C13H8BrClO
InChI:InChI=1/C13H8BrClO/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H
SMILES:c1cc(cc(c1)Br)C(=O)c1cccc(c1)Cl
Synonyms:- Methanone, (3-bromophenyl)(3-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.